Unit 12: Basic Concept of Organic Chemistry
1. Introduction to Organic Chemistry
Organic chemistry is a specialized branch of chemistry dedicated to the study of carbon-containing compounds. Historically, organic compounds were believed to originate only from living organisms, but this distinction was disproven with the synthesis of urea from inorganic compounds by Friedrich Wöhler in 1828. Today, the definition includes almost all compounds containing carbon, with a few notable exceptions that are typically classified as inorganic. These exceptions include carbon monoxide (CO), carbon dioxide (CO2), carbonates (e.g., Na2CO3), bicarbonates (e.g., NaHCO3), cyanides (e.g., KCN), and carbides (e.g., CaC2).
Reasons for Separate Study
The study of organic compounds warrants a separate branch of chemistry due to several distinctive characteristics of carbon and its compounds:
- Huge Number of Organic Compounds: There are millions of known organic compounds, far outnumbering inorganic compounds. This immense diversity stems from carbon's unique ability to form stable bonds with itself and other elements in various arrangements.
- Unique Properties: Organic compounds exhibit a wide range of unique physical and chemical properties. They are generally covalent, have lower melting and boiling points compared to ionic compounds, are often insoluble in water but soluble in organic solvents, and many are combustible.
- Covalent Bonding: Carbon primarily forms covalent bonds, sharing electrons with other atoms. This leads to the formation of stable molecules rather than ionic lattices, influencing their reactivity and physical state.
- Isomerism: A significant feature of organic chemistry is isomerism, where two or more compounds have the same molecular formula but different structural arrangements of atoms, leading to different properties. This phenomenon greatly contributes to the vast number of organic compounds.
Tetra-valency of Carbon
Carbon is positioned in Group 14 of the periodic table, possessing four valence electrons (electron configuration 1s² 2s² 2p²). This means carbon atoms have the capacity to form four chemical bonds to achieve a stable octet configuration, hence its tetra-valency. These four bonds can be single, double, or triple bonds, and they can be formed with other carbon atoms or with atoms of other elements like hydrogen, oxygen, nitrogen, sulfur, and halogens. This tetra-valency is crucial for carbon's ability to form complex and diverse molecular structures.
Example: In methane (CH4), carbon forms four single covalent bonds with four hydrogen atoms.
H
|
H - C - H
|
H
Catenation
Catenation is the exceptional ability of carbon atoms to link together with other carbon atoms to form long chains, branched chains, and cyclic (ring) structures. This property is primarily due to the strength and stability of the carbon-carbon (C-C) covalent bonds. While other elements like silicon can also catenate, carbon's ability is by far the most extensive, leading to compounds ranging from simple alkanes to complex polymers and biomolecules.
The strength of C-C bonds (approximately 348 kJ/mol) allows for the formation of very stable and long carbon skeletons, which is the backbone of all organic molecules.
- Example of a straight chain: Butane (
CH3-CH2-CH2-CH3) - Example of a branched chain: Isobutane (2-methylpropane)
- Example of a ring structure: Cyclohexane (
C6H12)
2. Classification of Organic Compounds
Organic compounds can be broadly classified based on the structure of their carbon skeleton and the presence of specific functional groups.
Acyclic (Open Chain) Compounds
These compounds contain carbon atoms linked in straight or branched chains, but do not form any rings. They are also known as aliphatic compounds.
- Alkanes: Saturated hydrocarbons containing only single
C-Cbonds. They have the general formulaCnH2n+2.- Example: Ethane (
C2H6)
- Example: Ethane (
- Alkenes: Unsaturated hydrocarbons containing at least one carbon-carbon double bond (
C=C). They have the general formulaCnH2n(for monounsaturated).- Example: Ethene (
C2H4)
- Example: Ethene (
- Alkynes: Unsaturated hydrocarbons containing at least one carbon-carbon triple bond (
C≡C). They have the general formulaCnH2n-2(for monounsaturated).- Example: Ethyne (
C2H2)
- Example: Ethyne (
Cyclic (Closed Chain) Compounds
These compounds contain carbon atoms arranged in a ring structure.
- Carbocyclic Compounds: Rings are formed exclusively by carbon atoms.
- Cycloalkanes: Saturated carbocyclic compounds with single
C-Cbonds forming a ring. General formulaCnH2n.- Example: Cyclopropane (
C3H6), Cyclohexane (C6H12)
- Example: Cyclopropane (
- Aromatic Compounds: Contain one or more benzene rings or rings with similar stability and electronic properties (delocalized pi electron systems). They possess a special type of stability called aromaticity.
- Example: Benzene (
C6H6), Naphthalene (C10H8)
- Example: Benzene (
- Cycloalkanes: Saturated carbocyclic compounds with single
- Heterocyclic Compounds: Rings contain at least one atom other than carbon (heteroatom) as part of the ring structure. Common heteroatoms include nitrogen, oxygen, and sulfur.
- Example: Pyridine (contains nitrogen), Furan (contains oxygen), Thiophene (contains sulfur)
Functional Groups
A functional group is an atom or a specific group of atoms within a molecule that is responsible for the characteristic chemical reactions of that molecule. The presence of a functional group largely determines the chemical properties and reactivity of an organic compound, regardless of the length or complexity of the carbon chain to which it is attached.
Here are some common functional groups:
| Functional Group | Formula | Class of Compound | Example |
|---|---|---|---|
| Hydroxyl | -OH |
Alcohols | Ethanol (CH3CH2OH) |
| Carboxyl | -COOH |
Carboxylic acids | Ethanoic acid (CH3COOH) |
| Aldehyde | -CHO |
Aldehydes | Ethanal (CH3CHO) |
| Amino | -NH2 |
Amines | Methylamine (CH3NH2) |
| Halo (Halogen) | -X (where X = F, Cl, Br, I) |
Haloalkanes (Alkyl halides) | Chloromethane (CH3Cl) |
| Ketone | C=O (within a chain) |
Ketones | Propanone (Acetone) (CH3COCH3) |
| Ether | -O- |
Ethers | Diethyl ether (CH3CH2OCH2CH3) |
Homologous Series
A homologous series is a series of organic compounds that belong to the same functional group and can be represented by a general formula. Members of a homologous series are called homologues, and they exhibit a systematic gradation in their physical properties and similar chemical properties.
Key characteristics of a homologous series:
- Same Functional Group: All members possess the same functional group, which dictates their chemical behavior.
- General Formula: All members can be represented by a common general formula (e.g.,
CnH2n+2for alkanes,CnH2n+1OHfor monohydric alcohols). - Similar Chemical Properties: Due to the same functional group, they undergo similar chemical reactions.
- Gradation in Physical Properties: Physical properties like melting points, boiling points, and density show a regular increase or decrease with an increase in molecular mass.
- Differ by a
-CH2-Unit: Each successive member in the series differs from the previous one by a-CH2-group and by 14 atomic mass units (12 for carbon + 2 for hydrogen).
Example: The alkane homologous series:
- Methane (
CH4) - Ethane (
C2H6) - Propane (
C3H8) - Butane (
C4H10)
Each member differs by CH2 and shows a gradual increase in boiling point.
3. Alkyl Groups
An alkyl group is a functional group or substituent derived from an alkane by removing one hydrogen atom. Alkyl groups are typically represented by the symbol R-. They are not stable compounds on their own but exist as part of larger molecules.
- Methyl group: Derived from methane (
CH4) by removing one H, givingCH3-. - Ethyl group: Derived from ethane (
C2H6) by removing one H, givingCH3CH2-orC2H5-. - Propyl group: Derived from propane (
C3H8) by removing one H. It can be n-propyl (CH3CH2CH2-) or isopropyl ((CH3)2CH-). - Butyl group: Derived from butane (
C4H10) by removing one H. There are four isomers: n-butyl, sec-butyl, isobutyl, and tert-butyl.
Classification of Alkyl Groups (Primary, Secondary, Tertiary)
Alkyl groups, and by extension the carbon atoms within them, can be classified based on the number of other carbon atoms to which the carbon atom bearing the 'free' valence (or functional group) is directly attached.
- Primary (1°) Alkyl Group: The carbon atom attached to the functional group (or the point of attachment to the main chain) is directly bonded to only one other carbon atom.
- Example: Methyl (
CH3-), Ethyl (CH3CH2-), n-Propyl (CH3CH2CH2-). InCH3CH2OH(ethanol), the carbon bearing-OHis a primary carbon.
- Example: Methyl (
- Secondary (2°) Alkyl Group: The carbon atom attached to the functional group is directly bonded to two other carbon atoms.
- Example: Isopropyl (
(CH3)2CH-), sec-Butyl (CH3CH2CH(CH3)-). In(CH3)2CHOH(isopropanol), the carbon bearing-OHis a secondary carbon.
- Example: Isopropyl (
- Tertiary (3°) Alkyl Group: The carbon atom attached to the functional group is directly bonded to three other carbon atoms.
- Example: tert-Butyl (
(CH3)3C-). In(CH3)3COH(tert-butanol), the carbon bearing-OHis a tertiary carbon.
- Example: tert-Butyl (
4. Structural Formula Representation
Representing the structure of organic molecules is crucial for understanding their properties and reactions. Different types of structural formulas provide varying levels of detail.
- Structural Formula (Expanded Structural Formula):
This formula shows all the atoms in a molecule and all the bonds connecting them. It provides the most complete picture of the molecular structure, clearly indicating connectivity and sometimes geometry (though 2D representations are limited). Each bond is explicitly drawn.
Example: Ethane (
C2H6)H H | | H - C - C - H | | H HExample: Ethanol (
CH3CH2OH)H H | | H - C - C - O - H | | H H - Contracted Formula (Condensed Structural Formula):
This formula simplifies the representation by omitting some or all of the covalent bonds and grouping atoms together. Bonds between carbon and hydrogen atoms are usually not shown, but bonds between carbon atoms (especially double and triple bonds) and between carbon and heteroatoms are often implied or sometimes shown for clarity. Functional groups are explicitly shown.
Example: Ethane:
CH3CH3Example: Ethanol:
CH3CH2OHExample: Propanone (acetone):
CH3COCH3Example: Butane:
CH3(CH2)2CH3(for longer chains,CH2units can be grouped) - Bond-line Structural Formula (Skeletal Formula):
This is the most abbreviated way to represent organic molecules, particularly useful for larger and more complex structures. It simplifies the representation by showing only the carbon skeleton and functional groups. The following conventions apply:
- Carbon atoms are not explicitly drawn; they are understood to be at the vertices and ends of lines.
- Hydrogen atoms attached to carbon atoms are also not explicitly drawn; their presence is implied to satisfy carbon's tetra-valency.
- Heteroatoms (O, N, S, halogens, etc.) and hydrogen atoms attached to heteroatoms are explicitly drawn.
- Single bonds are represented by single lines, double bonds by double lines, and triple bonds by triple lines.
- The lines are drawn in a zig-zag fashion to represent the tetrahedral geometry around
sp3hybridized carbons.
Example: Pentane (
CH3CH2CH2CH2CH3)/\/\Example: Cyclohexane (
C6H12)/\ / \ | | \ / \/Example: Butan-2-ol (
CH3CH(OH)CH2CH3)OH | /\/
5. Cracking and Reforming
These are crucial industrial processes in the petroleum industry, used to convert crude oil fractions into more valuable products, primarily gasoline components.
Cracking
Cracking is the process of breaking down large, long-chain hydrocarbon molecules (found in heavier fractions of crude oil like fuel oil and gas oil) into smaller, more valuable, and lighter hydrocarbon molecules (like those found in gasoline and gaseous fuels). This process is essential because the demand for lighter fractions, especially gasoline, often exceeds their natural abundance in crude oil.
There are two main types of cracking:
- Thermal Cracking: This method involves heating the heavy hydrocarbons to very high temperatures (450-750 °C) and pressures (up to 70 atm) without a catalyst. The high energy breaks the
C-Cbonds, producing a mixture of alkanes and alkenes. It typically yields a higher proportion of alkenes, which are valuable feedstocks for the petrochemical industry.- Example:
C15H32(long-chain alkane) →C8H18(octane) +C7H14(heptene)
- Example:
- Catalytic Cracking: This method uses a catalyst (typically zeolites, which are aluminosilicates) at lower temperatures (250-500 °C) and pressures compared to thermal cracking. Catalytic cracking produces a higher yield of branched alkanes and aromatic compounds, which are desirable components for gasoline due to their higher octane numbers. It is a more controlled process and is widely used in modern refineries.
- Example:
C16H34(hexadecane) →C8H18(isooctane) +C8H16(octene)
- Example:
Reforming (Catalytic Reforming)
Reforming is a process used to convert straight-chain alkanes (which have low octane numbers) into branched-chain alkanes, cycloalkanes, and aromatic hydrocarbons (which have higher octane numbers). This process improves the quality of gasoline by increasing its resistance to knocking. Reforming typically involves heating naphtha (a lighter fraction of crude oil) in the presence of a catalyst, often platinum or a platinum-rhenium alloy, at high temperatures (450-550 °C) and moderate pressures.
Key reactions in reforming include:
- Isomerization: Straight-chain alkanes convert to branched-chain alkanes.
- Example: n-Heptane (
CH3(CH2)5CH3) → 2,2,3-Trimethylbutane (a branched isomer)
- Example: n-Heptane (
- Cyclization and Dehydrogenation: Alkanes convert to cycloalkanes, which then dehydrogenate to form aromatic compounds.
- Example: n-Heptane → Methylcyclohexane → Toluene (
C7H8, an aromatic compound)
- Example: n-Heptane → Methylcyclohexane → Toluene (
Quality of Gasoline and Diesel
The quality of fuels is critical for engine performance and efficiency.
- Octane Number (for Gasoline):
The octane number is a standard measure of a gasoline's resistance to "knocking" or "pinging" during combustion in an internal combustion engine. Knocking occurs when the fuel-air mixture ignites prematurely and unevenly, leading to a rapid, uncontrolled combustion that reduces engine efficiency and can cause damage. A higher octane number indicates greater resistance to knocking and allows for higher compression ratios in engines, leading to better performance and fuel economy.
The octane scale is based on two reference hydrocarbons:
- n-Heptane: Assigned an octane number of 0 (very prone to knocking).
- Isooctane (2,2,4-trimethylpentane): Assigned an octane number of 100 (very resistant to knocking).
A gasoline with an octane number of 95 performs like a mixture of 95% isooctane and 5% n-heptane.
- Cetane Number (for Diesel):
The cetane number is a measure of the ignition quality of diesel fuel. It indicates how quickly the fuel ignites after being injected into the combustion chamber. A higher cetane number signifies a shorter ignition delay and better cold-starting properties, smoother combustion, and reduced engine noise. Diesel fuel with a low cetane number causes a longer ignition delay, leading to a build-up of fuel and a sudden, uncontrolled ignition, resulting in "diesel knock."
The cetane scale is based on:
- n-Hexadecane (cetane): Assigned a cetane number of 100 (very good ignition quality).
- alpha-Methylnaphthalene: Assigned a cetane number of 0 (poor ignition quality).
Gasoline Additives
Additives are substances blended into gasoline to improve its performance and reduce harmful emissions.
- Anti-knocking Agents: These additives increase the octane number of gasoline, preventing engine knocking.
- Tetraethyl lead (TEL,
(C2H5)4Pb): Historically, TEL was widely used as an effective anti-knocking agent. However, due to its toxicity and the environmental harm caused by lead emissions, its use in gasoline has been phased out globally and is now banned in most countries. - MTBE (Methyl tert-butyl ether,
(CH3)3COCH3): MTBE was introduced as a replacement for TEL to boost octane and oxygenate gasoline, promoting more complete combustion. While effective, concerns about groundwater contamination due to its solubility and persistence have led to its ban or restricted use in many regions. - Ethanol and other oxygenates: Alcohols like ethanol are now commonly used as octane enhancers and oxygenates in gasoline blends, offering a more environmentally friendly alternative.
- Tetraethyl lead (TEL,